C7H15O8P — CID 24763921
(1S,2R)-1-(2,5-dihydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)butane-1,2,4-triol (PubChem CID 24763921) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is (1S,2R)-1-(2,5-dihydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)butane-1,2,4-triol.
| Compound Name | (1S,2R)-1-(2,5-dihydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 24763921 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (1S,2R)-1-(2,5-dihydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)butane-1,2,4-triol |
| SMILES | O=P1(O)OCC(O)([C@@H](O)[C@H](O)CCO)CO1 |
| InChI | InChI=1S/C7H15O8P/c8-2-1-5(9)6(10)7(11)3-14-16(12,13)15-4-7/h5-6,8-11H,1-4H2,(H,12,13)/t5-,6+/m1/s1 |
| InChIKey | YAQAVWFZDPPYII-RITPCOANSA-N |
| XLogP | -2.03 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|