C29H17F42O4PS2 — CID 163324548
5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanylmethyl)-2-hydroxy-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 163324548) has the molecular formula C29H17F42O4PS2 and a molecular weight of 1322.48 g/mol. Its IUPAC name is 5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanylmethyl)-2-hydroxy-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanylmethyl)-2-hydroxy-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 163324548 |
| Molecular Formula | C29H17F42O4PS2 |
| Molecular Weight | 1322.48 g/mol |
| Exact Mass | 1321.96 |
| IUPAC Name | 5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecylsulfanylmethyl)-2-hydroxy-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | O=P1(O)OCC(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CO1 |
| InChI | InChI=1S/C29H17F42O4PS2/c30-10(31,12(34,35)14(38,39)16(42,43)18(46,47)20(50,51)22(54,55)24(58,59)26(62,63)28(66,67)68)1-3-77-7-9(5-74-76(72,73)75-6-9)8-78-4-2-11(32,33)13(36,37)15(40,41)17(44,45)19(48,49)21(52,53)23(56,57)25(60,61)27(64,65)29(69,70)71/h1-8H2,(H,72,73) |
| InChIKey | NAGFOIMIKUARSC-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1322.48 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|