C29H13F46O4PS2 — CID 101197410
2-hydroxy-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 101197410) has the molecular formula C29H13F46O4PS2 and a molecular weight of 1394.44 g/mol. Its IUPAC name is 2-hydroxy-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-hydroxy-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 101197410 |
| Molecular Formula | C29H13F46O4PS2 |
| Molecular Weight | 1394.44 g/mol |
| Exact Mass | 1393.93 |
| IUPAC Name | 2-hydroxy-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | O=P1(O)OCC(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CO1 |
| InChI | InChI=1S/C29H13F46O4PS2/c30-8(31,10(34,35)12(38,39)14(42,43)16(46,47)18(50,51)20(54,55)22(58,59)24(62,63)26(66,67)28(70,71)72)1-3-81-7(5-78-80(76,77)79-6-7)82-4-2-9(32,33)11(36,37)13(40,41)15(44,45)17(48,49)19(52,53)21(56,57)23(60,61)25(64,65)27(68,69)29(73,74)75/h1-6H2,(H,76,77) |
| InChIKey | BXDOBJXBYWDWFR-UHFFFAOYSA-N |
| XLogP | 16.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1394.44 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|