C17H20F17NO5S — CID 163824565
bis(2-hydroxyethyl)-(hydroxymethyl)azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate (PubChem CID 163824565) has the molecular formula C17H20F17NO5S and a molecular weight of 673.38 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-(hydroxymethyl)azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate.
| Compound Name | bis(2-hydroxyethyl)-(hydroxymethyl)azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate |
|---|---|
| PubChem CID | 163824565 |
| Molecular Formula | C17H20F17NO5S |
| Molecular Weight | 673.38 g/mol |
| Exact Mass | 673.08 |
| IUPAC Name | bis(2-hydroxyethyl)-(hydroxymethyl)azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate |
| SMILES | O=C([O-])CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OCC[NH+](CO)CCO |
| InChI | InChI=1S/C12H7F17O2S.C5H13NO3/c13-5(14,1-2-32-3-4(30)31)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29;7-3-1-6(5-9)2-4-8/h1-3H2,(H,30,31);7-9H,1-5H2 |
| InChIKey | NYIJYFLFLGFZCB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|