C18H21F17N2O4S — CID 163497456
[(5S)-5-amino-5-carboxypentyl]azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate (PubChem CID 163497456) has the molecular formula C18H21F17N2O4S and a molecular weight of 684.41 g/mol. Its IUPAC name is [(5S)-5-amino-5-carboxypentyl]azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate.
| Compound Name | [(5S)-5-amino-5-carboxypentyl]azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate |
|---|---|
| PubChem CID | 163497456 |
| Molecular Formula | C18H21F17N2O4S |
| Molecular Weight | 684.41 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | [(5S)-5-amino-5-carboxypentyl]azanium;2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)acetate |
| SMILES | N[C@@H](CCCC[NH3+])C(=O)O.O=C([O-])CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H7F17O2S.C6H14N2O2/c13-5(14,1-2-32-3-4(30)31)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29;7-4-2-1-3-5(8)6(9)10/h1-3H2,(H,30,31);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | CRYDJAUBOAUGDS-ZSCHJXSPSA-N |
| XLogP | 3.68 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|