C19H21F17N2O6 — CID 163722062
[(5S)-5-amino-5-carboxypentyl]azanium;2-carboxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoate (PubChem CID 163722062) has the molecular formula C19H21F17N2O6 and a molecular weight of 696.35 g/mol. Its IUPAC name is [(5S)-5-amino-5-carboxypentyl]azanium;2-carboxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoate.
| Compound Name | [(5S)-5-amino-5-carboxypentyl]azanium;2-carboxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoate |
|---|---|
| PubChem CID | 163722062 |
| Molecular Formula | C19H21F17N2O6 |
| Molecular Weight | 696.35 g/mol |
| Exact Mass | 696.11 |
| IUPAC Name | [(5S)-5-amino-5-carboxypentyl]azanium;2-carboxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecanoate |
| SMILES | N[C@@H](CCCC[NH3+])C(=O)O.O=C([O-])C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H7F17O4.C6H14N2O2/c14-6(15,2-1-3(4(31)32)5(33)34)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30;7-4-2-1-3-5(8)6(9)10/h3H,1-2H2,(H,31,32)(H,33,34);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | KSKYRYYIXYADIY-ZSCHJXSPSA-N |
| XLogP | 3.04 |
| TPSA | 168.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|