C6H14Mg3N2O8P2 — CID 173217572
trimagnesium;(2S)-2,6-diaminohexanoic acid;diphosphite (PubChem CID 173217572) has the molecular formula C6H14Mg3N2O8P2 and a molecular weight of 377.05 g/mol. Its IUPAC name is trimagnesium;(2S)-2,6-diaminohexanoic acid;diphosphite.
| Compound Name | trimagnesium;(2S)-2,6-diaminohexanoic acid;diphosphite |
|---|---|
| PubChem CID | 173217572 |
| Molecular Formula | C6H14Mg3N2O8P2 |
| Molecular Weight | 377.05 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | trimagnesium;(2S)-2,6-diaminohexanoic acid;diphosphite |
| SMILES | NCCCC[C@H](N)C(=O)O.[Mg+2].[Mg+2].[Mg+2].[O-]P([O-])[O-].[O-]P([O-])[O-] |
| InChI | InChI=1S/C6H14N2O2.3Mg.2O3P/c7-4-2-1-3-5(8)6(9)10;;;;2*1-4(2)3/h5H,1-4,7-8H2,(H,9,10);;;;;/q;3*+2;2*-3/t5-;;;;;/m0...../s1 |
| InChIKey | FICUOKXBNZCGCL-HNJBGNBTSA-N |
| XLogP | -7.03 |
| TPSA | 227.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.05 |
| LogP ≤ 5 | -7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|