C8H13F5N2O3S — CID 168879929
(2S)-2-amino-4-(3,3,4,4,4-pentafluorobutylsulfonimidoyl)butanoic acid (PubChem CID 168879929) has the molecular formula C8H13F5N2O3S and a molecular weight of 312.26 g/mol. Its IUPAC name is (2S)-2-amino-4-(3,3,4,4,4-pentafluorobutylsulfonimidoyl)butanoic acid.
| Compound Name | (2S)-2-amino-4-(3,3,4,4,4-pentafluorobutylsulfonimidoyl)butanoic acid |
|---|---|
| PubChem CID | 168879929 |
| Molecular Formula | C8H13F5N2O3S |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2S)-2-amino-4-(3,3,4,4,4-pentafluorobutylsulfonimidoyl)butanoic acid |
| SMILES | [H]N=S(=O)(CC[C@H](N)C(=O)O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13F5N2O3S/c9-7(10,8(11,12)13)2-4-19(15,18)3-1-5(14)6(16)17/h5,15H,1-4,14H2,(H,16,17)/t5-,19?/m0/s1 |
| InChIKey | WFBWBXASMFSWIP-OLUDNYHUSA-N |
| XLogP | 1.42 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|