C15H23FN2O3S — CID 174245948
(2S)-2-amino-4-[[3-(2-fluorophenyl)-3-methylbutyl]sulfonimidoyl]butanoic acid (PubChem CID 174245948) has the molecular formula C15H23FN2O3S and a molecular weight of 330.42 g/mol. Its IUPAC name is (2S)-2-amino-4-[[3-(2-fluorophenyl)-3-methylbutyl]sulfonimidoyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[3-(2-fluorophenyl)-3-methylbutyl]sulfonimidoyl]butanoic acid |
|---|---|
| PubChem CID | 174245948 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (2S)-2-amino-4-[[3-(2-fluorophenyl)-3-methylbutyl]sulfonimidoyl]butanoic acid |
| SMILES | [H]N=S(=O)(CC[C@H](N)C(=O)O)CCC(C)(C)c1ccccc1F |
| InChI | InChI=1S/C15H23FN2O3S/c1-15(2,11-5-3-4-6-12(11)16)8-10-22(18,21)9-7-13(17)14(19)20/h3-6,13,18H,7-10,17H2,1-2H3,(H,19,20)/t13-,22?/m0/s1 |
| InChIKey | VGHTVPRWQORTOI-JHAYDQECSA-N |
| XLogP | 2.34 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |