C17H22F13NO4 — CID 175685726
2-(2-propoxyethoxy)ethyl 2-amino-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate (PubChem CID 175685726) has the molecular formula C17H22F13NO4 and a molecular weight of 551.34 g/mol. Its IUPAC name is 2-(2-propoxyethoxy)ethyl 2-amino-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate.
| Compound Name | 2-(2-propoxyethoxy)ethyl 2-amino-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate |
|---|---|
| PubChem CID | 175685726 |
| Molecular Formula | C17H22F13NO4 |
| Molecular Weight | 551.34 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 2-(2-propoxyethoxy)ethyl 2-amino-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate |
| SMILES | CCCOCCOCCOC(=O)C(N)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H22F13NO4/c1-2-5-33-6-7-34-8-9-35-11(32)10(31)3-4-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h10H,2-9,31H2,1H3 |
| InChIKey | QEUDXYQRHICBMV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|