C7H13ClF3NO2 — CID 154727174
ethyl (2S)-2-amino-5,5,5-trifluoropentanoate;hydrochloride (PubChem CID 154727174) has the molecular formula C7H13ClF3NO2 and a molecular weight of 235.63 g/mol. Its IUPAC name is ethyl (2S)-2-amino-5,5,5-trifluoropentanoate;hydrochloride.
| Compound Name | ethyl (2S)-2-amino-5,5,5-trifluoropentanoate;hydrochloride |
|---|---|
| PubChem CID | 154727174 |
| Molecular Formula | C7H13ClF3NO2 |
| Molecular Weight | 235.63 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | ethyl (2S)-2-amino-5,5,5-trifluoropentanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](N)CCC(F)(F)F.Cl |
| InChI | InChI=1S/C7H12F3NO2.ClH/c1-2-13-6(12)5(11)3-4-7(8,9)10;/h5H,2-4,11H2,1H3;1H/t5-;/m0./s1 |
| InChIKey | NIYHVSZHGYJCQC-JEDNCBNOSA-N |
| XLogP | 1.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.63 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |