C9H16F3NO2S — CID 64553138
ethyl 2-amino-4-(3,3,3-trifluoropropylsulfanyl)butanoate (PubChem CID 64553138) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is ethyl 2-amino-4-(3,3,3-trifluoropropylsulfanyl)butanoate.
| Compound Name | ethyl 2-amino-4-(3,3,3-trifluoropropylsulfanyl)butanoate |
|---|---|
| PubChem CID | 64553138 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | ethyl 2-amino-4-(3,3,3-trifluoropropylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(N)CCSCCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S/c1-2-15-8(14)7(13)3-5-16-6-4-9(10,11)12/h7H,2-6,13H2,1H3 |
| InChIKey | RWHBHWMBYXYWJQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|