C12H22F3NO3S — CID 170769798
tert-butyl 2-amino-4-(4,4,4-trifluoro-3-hydroxybutyl)sulfanylbutanoate (PubChem CID 170769798) has the molecular formula C12H22F3NO3S and a molecular weight of 317.37 g/mol. Its IUPAC name is tert-butyl 2-amino-4-(4,4,4-trifluoro-3-hydroxybutyl)sulfanylbutanoate.
| Compound Name | tert-butyl 2-amino-4-(4,4,4-trifluoro-3-hydroxybutyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 170769798 |
| Molecular Formula | C12H22F3NO3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | tert-butyl 2-amino-4-(4,4,4-trifluoro-3-hydroxybutyl)sulfanylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(N)CCSCCC(O)C(F)(F)F |
| InChI | InChI=1S/C12H22F3NO3S/c1-11(2,3)19-10(18)8(16)4-6-20-7-5-9(17)12(13,14)15/h8-9,17H,4-7,16H2,1-3H3 |
| InChIKey | LBAYZECSAUKSIV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|