C13H25ClFNO4 — CID 155412583
ditert-butyl (2S,4S)-2-amino-4-fluoropentanedioate;hydrochloride (PubChem CID 155412583) has the molecular formula C13H25ClFNO4 and a molecular weight of 313.80 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-amino-4-fluoropentanedioate;hydrochloride.
| Compound Name | ditert-butyl (2S,4S)-2-amino-4-fluoropentanedioate;hydrochloride |
|---|---|
| PubChem CID | 155412583 |
| Molecular Formula | C13H25ClFNO4 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ditert-butyl (2S,4S)-2-amino-4-fluoropentanedioate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)C[C@H](F)C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C13H24FNO4.ClH/c1-12(2,3)18-10(16)8(14)7-9(15)11(17)19-13(4,5)6;/h8-9H,7,15H2,1-6H3;1H/t8-,9-;/m0./s1 |
| InChIKey | UFRLJCVVBPAIGK-OZZZDHQUSA-N |
| XLogP | 2.15 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |