C13H17Cl2NO2S — CID 65317915
ethyl 2-amino-4-[(2,5-dichlorophenyl)methylsulfanyl]butanoate (PubChem CID 65317915) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is ethyl 2-amino-4-[(2,5-dichlorophenyl)methylsulfanyl]butanoate.
| Compound Name | ethyl 2-amino-4-[(2,5-dichlorophenyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 65317915 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | ethyl 2-amino-4-[(2,5-dichlorophenyl)methylsulfanyl]butanoate |
| SMILES | CCOC(=O)C(N)CCSCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2S/c1-2-18-13(17)12(16)5-6-19-8-9-7-10(14)3-4-11(9)15/h3-4,7,12H,2,5-6,8,16H2,1H3 |
| InChIKey | YBUGXSMMCNKTGK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|