C13H16Cl2O2S — CID 83038841
ethyl 2-(2,5-dichlorophenyl)sulfanylpentanoate (PubChem CID 83038841) has the molecular formula C13H16Cl2O2S and a molecular weight of 307.24 g/mol. Its IUPAC name is ethyl 2-(2,5-dichlorophenyl)sulfanylpentanoate.
| Compound Name | ethyl 2-(2,5-dichlorophenyl)sulfanylpentanoate |
|---|---|
| PubChem CID | 83038841 |
| Molecular Formula | C13H16Cl2O2S |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | ethyl 2-(2,5-dichlorophenyl)sulfanylpentanoate |
| SMILES | CCCC(Sc1cc(Cl)ccc1Cl)C(=O)OCC |
| InChI | InChI=1S/C13H16Cl2O2S/c1-3-5-11(13(16)17-4-2)18-12-8-9(14)6-7-10(12)15/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | AFEWPMCXTJXXPG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |