C12H14Cl2N2O3S — CID 47266788
ethyl N-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]carbamate (PubChem CID 47266788) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is ethyl N-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]carbamate.
| Compound Name | ethyl N-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]carbamate |
|---|---|
| PubChem CID | 47266788 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | ethyl N-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]carbamate |
| SMILES | CCOC(=O)NNC(=O)C(C)Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3S/c1-3-19-12(18)16-15-11(17)7(2)20-10-6-8(13)4-5-9(10)14/h4-7H,3H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | FAKDWGHPIOGGCL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|