C21H25Cl2NO3S — CID 55838058
2-(2,5-dichlorophenyl)sulfanyl-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide (PubChem CID 55838058) has the molecular formula C21H25Cl2NO3S and a molecular weight of 442.41 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55838058 |
| Molecular Formula | C21H25Cl2NO3S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)C(C)Sc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C21H25Cl2NO3S/c1-3-26-9-10-27-14-17-6-4-5-16(11-17)13-24-21(25)15(2)28-20-12-18(22)7-8-19(20)23/h4-8,11-12,15H,3,9-10,13-14H2,1-2H3,(H,24,25) |
| InChIKey | HDKVRPKLDFRQEV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|