C21H28ClN3O2 — CID 111176834
1-[(3-chlorophenyl)methyl]-3-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111176834) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111176834 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | CCOCCOCc1cccc(CN/C(=N/C)NCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H28ClN3O2/c1-3-26-10-11-27-16-19-8-4-6-17(12-19)14-24-21(23-2)25-15-18-7-5-9-20(22)13-18/h4-9,12-13H,3,10-11,14-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | LRSXQTMQJZOEBB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|