C14H13Cl2NO2S — CID 7870521
(2R)-2-(2,5-dichlorophenyl)sulfanyl-N-(furan-2-ylmethyl)propanamide (PubChem CID 7870521) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is (2R)-2-(2,5-dichlorophenyl)sulfanyl-N-(furan-2-ylmethyl)propanamide.
| Compound Name | (2R)-2-(2,5-dichlorophenyl)sulfanyl-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 7870521 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | (2R)-2-(2,5-dichlorophenyl)sulfanyl-N-(furan-2-ylmethyl)propanamide |
| SMILES | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-9(14(18)17-8-11-3-2-6-19-11)20-13-7-10(15)4-5-12(13)16/h2-7,9H,8H2,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | FWTKARVGRVSCQQ-SECBINFHSA-N |
| XLogP | 4.38 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |