C18H17Cl2FN2O2S — CID 55974574
N-[2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]ethyl]-2-fluorobenzamide (PubChem CID 55974574) has the molecular formula C18H17Cl2FN2O2S and a molecular weight of 415.32 g/mol. Its IUPAC name is N-[2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 55974574 |
| Molecular Formula | C18H17Cl2FN2O2S |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-[2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]ethyl]-2-fluorobenzamide |
| SMILES | CC(Sc1cc(Cl)ccc1Cl)C(=O)NCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H17Cl2FN2O2S/c1-11(26-16-10-12(19)6-7-14(16)20)17(24)22-8-9-23-18(25)13-4-2-3-5-15(13)21/h2-7,10-11H,8-9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | LLMRYDVNQQLHGC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|