C12H17ClFN3O2 — CID 119299574
N-[2-(2-aminopropanoylamino)ethyl]-2-fluorobenzamide;hydrochloride (PubChem CID 119299574) has the molecular formula C12H17ClFN3O2 and a molecular weight of 289.74 g/mol. Its IUPAC name is N-[2-(2-aminopropanoylamino)ethyl]-2-fluorobenzamide;hydrochloride.
| Compound Name | N-[2-(2-aminopropanoylamino)ethyl]-2-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119299574 |
| Molecular Formula | C12H17ClFN3O2 |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[2-(2-aminopropanoylamino)ethyl]-2-fluorobenzamide;hydrochloride |
| SMILES | CC(N)C(=O)NCCNC(=O)c1ccccc1F.Cl |
| InChI | InChI=1S/C12H16FN3O2.ClH/c1-8(14)11(17)15-6-7-16-12(18)9-4-2-3-5-10(9)13;/h2-5,8H,6-7,14H2,1H3,(H,15,17)(H,16,18);1H |
| InChIKey | NOTZDRWQPRFNJN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|