C25H35NO4 — CID 55690103
2-(4-tert-butylphenoxy)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide (PubChem CID 55690103) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55690103 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)C(C)Oc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C25H35NO4/c1-6-28-14-15-29-18-21-9-7-8-20(16-21)17-26-24(27)19(2)30-23-12-10-22(11-13-23)25(3,4)5/h7-13,16,19H,6,14-15,17-18H2,1-5H3,(H,26,27) |
| InChIKey | FDHYLQPKWLTYMY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|