C20H31N5O3 — CID 97260054
(2R)-2-(5-tert-butyltetrazol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide (PubChem CID 97260054) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (2R)-2-(5-tert-butyltetrazol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide.
| Compound Name | (2R)-2-(5-tert-butyltetrazol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 97260054 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (2R)-2-(5-tert-butyltetrazol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]propanamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)[C@@H](C)n2nnnc2C(C)(C)C)c1 |
| InChI | InChI=1S/C20H31N5O3/c1-6-27-10-11-28-14-17-9-7-8-16(12-17)13-21-18(26)15(2)25-19(20(3,4)5)22-23-24-25/h7-9,12,15H,6,10-11,13-14H2,1-5H3,(H,21,26)/t15-/m1/s1 |
| InChIKey | GNZJOOAPBKHVHQ-OAHLLOKOSA-N |
| XLogP | 2.40 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|