C23H30N4O3 — CID 60573945
5-(2,5-dimethylpyrrol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 60573945) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 5-(2,5-dimethylpyrrol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-(2,5-dimethylpyrrol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60573945 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 5-(2,5-dimethylpyrrol-1-yl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)c2cnn(C)c2-n2c(C)ccc2C)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-5-29-11-12-30-16-20-8-6-7-19(13-20)14-24-22(28)21-15-25-26(4)23(21)27-17(2)9-10-18(27)3/h6-10,13,15H,5,11-12,14,16H2,1-4H3,(H,24,28) |
| InChIKey | KIKLZTMCBXBGLQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|