C20H25NO5S — CID 39586980
N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-methylsulfonylbenzamide (PubChem CID 39586980) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 39586980 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-methylsulfonylbenzamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)c2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C20H25NO5S/c1-3-25-10-11-26-15-17-7-4-6-16(12-17)14-21-20(22)18-8-5-9-19(13-18)27(2,23)24/h4-9,12-13H,3,10-11,14-15H2,1-2H3,(H,21,22) |
| InChIKey | BJFHYUMACCZIBH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|