C21H27FN2O5S — CID 55796196
3-(dimethylsulfamoyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-4-fluorobenzamide (PubChem CID 55796196) has the molecular formula C21H27FN2O5S and a molecular weight of 438.52 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-4-fluorobenzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 55796196 |
| Molecular Formula | C21H27FN2O5S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-4-fluorobenzamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)c2ccc(F)c(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C21H27FN2O5S/c1-4-28-10-11-29-15-17-7-5-6-16(12-17)14-23-21(25)18-8-9-19(22)20(13-18)30(26,27)24(2)3/h5-9,12-13H,4,10-11,14-15H2,1-3H3,(H,23,25) |
| InChIKey | UUUMVKSSVMZYPR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|