C13H17ClN2O3S — CID 102666759
ethyl 2-amino-3-[(4-carbamoyl-2-chlorophenyl)methylsulfanyl]propanoate (PubChem CID 102666759) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is ethyl 2-amino-3-[(4-carbamoyl-2-chlorophenyl)methylsulfanyl]propanoate.
| Compound Name | ethyl 2-amino-3-[(4-carbamoyl-2-chlorophenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 102666759 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | ethyl 2-amino-3-[(4-carbamoyl-2-chlorophenyl)methylsulfanyl]propanoate |
| SMILES | CCOC(=O)C(N)CSCc1ccc(C(N)=O)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O3S/c1-2-19-13(18)11(15)7-20-6-9-4-3-8(12(16)17)5-10(9)14/h3-5,11H,2,6-7,15H2,1H3,(H2,16,17) |
| InChIKey | UWMZDHLXCUPHSL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |