C13H17ClO2S — CID 107760836
3-chloro-4-(2-methylbutylsulfanylmethyl)benzoic acid (PubChem CID 107760836) has the molecular formula C13H17ClO2S and a molecular weight of 272.80 g/mol. Its IUPAC name is 3-chloro-4-(2-methylbutylsulfanylmethyl)benzoic acid.
| Compound Name | 3-chloro-4-(2-methylbutylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 107760836 |
| Molecular Formula | C13H17ClO2S |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-chloro-4-(2-methylbutylsulfanylmethyl)benzoic acid |
| SMILES | CCC(C)CSCc1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H17ClO2S/c1-3-9(2)7-17-8-11-5-4-10(13(15)16)6-12(11)14/h4-6,9H,3,7-8H2,1-2H3,(H,15,16) |
| InChIKey | AUKYOKOGMDUGAE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |