C12H17BrN2O2S — CID 104797590
ethyl 2-amino-4-[(5-bromo-2-pyridinyl)methylsulfanyl]butanoate (PubChem CID 104797590) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is ethyl 2-amino-4-[(5-bromo-2-pyridinyl)methylsulfanyl]butanoate.
| Compound Name | ethyl 2-amino-4-[(5-bromo-2-pyridinyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 104797590 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | ethyl 2-amino-4-[(5-bromo-2-pyridinyl)methylsulfanyl]butanoate |
| SMILES | CCOC(=O)C(N)CCSCc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H17BrN2O2S/c1-2-17-12(16)11(14)5-6-18-8-10-4-3-9(13)7-15-10/h3-4,7,11H,2,5-6,8,14H2,1H3 |
| InChIKey | AWPMGJNOETWSLH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|