C11H15ClN2O2S — CID 79255349
methyl 2-amino-4-[(4-chloro-2-pyridinyl)methylsulfanyl]butanoate (PubChem CID 79255349) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is methyl 2-amino-4-[(4-chloro-2-pyridinyl)methylsulfanyl]butanoate.
| Compound Name | methyl 2-amino-4-[(4-chloro-2-pyridinyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 79255349 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methyl 2-amino-4-[(4-chloro-2-pyridinyl)methylsulfanyl]butanoate |
| SMILES | COC(=O)C(N)CCSCc1cc(Cl)ccn1 |
| InChI | InChI=1S/C11H15ClN2O2S/c1-16-11(15)10(13)3-5-17-7-9-6-8(12)2-4-14-9/h2,4,6,10H,3,5,7,13H2,1H3 |
| InChIKey | UVMWMXYNONPZRL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|