C9H10ClNO2S — CID 79255226
2-[(4-chloro-2-pyridinyl)methylsulfanyl]propanoic acid (PubChem CID 79255226) has the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. Its IUPAC name is 2-[(4-chloro-2-pyridinyl)methylsulfanyl]propanoic acid.
| Compound Name | 2-[(4-chloro-2-pyridinyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 79255226 |
| Molecular Formula | C9H10ClNO2S |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 2-[(4-chloro-2-pyridinyl)methylsulfanyl]propanoic acid |
| SMILES | CC(SCc1cc(Cl)ccn1)C(=O)O |
| InChI | InChI=1S/C9H10ClNO2S/c1-6(9(12)13)14-5-8-4-7(10)2-3-11-8/h2-4,6H,5H2,1H3,(H,12,13) |
| InChIKey | ZHWGNVKPBFKFPT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |