C10H15NO3S — CID 63034284
methyl 2-amino-4-(furan-2-ylmethylsulfanyl)butanoate (PubChem CID 63034284) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 2-amino-4-(furan-2-ylmethylsulfanyl)butanoate.
| Compound Name | methyl 2-amino-4-(furan-2-ylmethylsulfanyl)butanoate |
|---|---|
| PubChem CID | 63034284 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 2-amino-4-(furan-2-ylmethylsulfanyl)butanoate |
| SMILES | COC(=O)C(N)CCSCc1ccco1 |
| InChI | InChI=1S/C10H15NO3S/c1-13-10(12)9(11)4-6-15-7-8-3-2-5-14-8/h2-3,5,9H,4,6-7,11H2,1H3 |
| InChIKey | AUBMDGHIZARDAD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|