C9H15NOS — CID 64611326
4-(furan-2-ylmethylsulfanyl)butan-2-amine (PubChem CID 64611326) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfanyl)butan-2-amine.
| Compound Name | 4-(furan-2-ylmethylsulfanyl)butan-2-amine |
|---|---|
| PubChem CID | 64611326 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 4-(furan-2-ylmethylsulfanyl)butan-2-amine |
| SMILES | CC(N)CCSCc1ccco1 |
| InChI | InChI=1S/C9H15NOS/c1-8(10)4-6-12-7-9-3-2-5-11-9/h2-3,5,8H,4,6-7,10H2,1H3 |
| InChIKey | LIKCLGNILSMYPH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|