C14H21NO3S — CID 63033737
ethyl 2-(cyclopropylamino)-4-(furan-2-ylmethylsulfanyl)butanoate (PubChem CID 63033737) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is ethyl 2-(cyclopropylamino)-4-(furan-2-ylmethylsulfanyl)butanoate.
| Compound Name | ethyl 2-(cyclopropylamino)-4-(furan-2-ylmethylsulfanyl)butanoate |
|---|---|
| PubChem CID | 63033737 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | ethyl 2-(cyclopropylamino)-4-(furan-2-ylmethylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(CCSCc1ccco1)NC1CC1 |
| InChI | InChI=1S/C14H21NO3S/c1-2-17-14(16)13(15-11-5-6-11)7-9-19-10-12-4-3-8-18-12/h3-4,8,11,13,15H,2,5-7,9-10H2,1H3 |
| InChIKey | GSBSEMPEEKMDST-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|