C12H16O4S — CID 103485680
ethyl 5-(furan-2-ylmethylsulfanyl)-4-oxopentanoate (PubChem CID 103485680) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is ethyl 5-(furan-2-ylmethylsulfanyl)-4-oxopentanoate.
| Compound Name | ethyl 5-(furan-2-ylmethylsulfanyl)-4-oxopentanoate |
|---|---|
| PubChem CID | 103485680 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | ethyl 5-(furan-2-ylmethylsulfanyl)-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)CSCc1ccco1 |
| InChI | InChI=1S/C12H16O4S/c1-2-15-12(14)6-5-10(13)8-17-9-11-4-3-7-16-11/h3-4,7H,2,5-6,8-9H2,1H3 |
| InChIKey | RGTKWUNANCKWKP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |