C9H14F3NO3S — CID 23115730
2-amino-6-(3,3,3-trifluoro-2-oxopropyl)sulfanylhexanoic acid (PubChem CID 23115730) has the molecular formula C9H14F3NO3S and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-amino-6-(3,3,3-trifluoro-2-oxopropyl)sulfanylhexanoic acid.
| Compound Name | 2-amino-6-(3,3,3-trifluoro-2-oxopropyl)sulfanylhexanoic acid |
|---|---|
| PubChem CID | 23115730 |
| Molecular Formula | C9H14F3NO3S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-amino-6-(3,3,3-trifluoro-2-oxopropyl)sulfanylhexanoic acid |
| SMILES | NC(CCCCSCC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H14F3NO3S/c10-9(11,12)7(14)5-17-4-2-1-3-6(13)8(15)16/h6H,1-5,13H2,(H,15,16) |
| InChIKey | MLCNQIFFJPOFPC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|