C16H21F3N2O2S — CID 68935168
(2S)-2-amino-N-(2-phenylethyl)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide (PubChem CID 68935168) has the molecular formula C16H21F3N2O2S and a molecular weight of 362.42 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-phenylethyl)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide.
| Compound Name | (2S)-2-amino-N-(2-phenylethyl)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 68935168 |
| Molecular Formula | C16H21F3N2O2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2S)-2-amino-N-(2-phenylethyl)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
| SMILES | N[C@@H](CCCSCC(=O)C(F)(F)F)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C16H21F3N2O2S/c17-16(18,19)14(22)11-24-10-4-7-13(20)15(23)21-9-8-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11,20H2,(H,21,23)/t13-/m0/s1 |
| InChIKey | FUYKADFLEXYSIY-ZDUSSCGKSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|