C16H12F17O4S- — CID 162489743
5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethoxy)-5-oxopentanoate (PubChem CID 162489743) has the molecular formula C16H12F17O4S- and a molecular weight of 623.30 g/mol. Its IUPAC name is 5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethoxy)-5-oxopentanoate.
| Compound Name | 5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethoxy)-5-oxopentanoate |
|---|---|
| PubChem CID | 162489743 |
| Molecular Formula | C16H12F17O4S- |
| Molecular Weight | 623.30 g/mol |
| Exact Mass | 623.02 |
| IUPAC Name | 5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethoxy)-5-oxopentanoate |
| SMILES | O=C([O-])CCCC(=O)OCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13F17O4S/c17-9(18,4-5-38-6-37-8(36)3-1-2-7(34)35)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h1-6H2,(H,34,35)/p-1 |
| InChIKey | XVYBUFRJQFNGAZ-UHFFFAOYSA-M |
| XLogP | 5.54 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.30 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|