C21H28F17N3O2S — CID 163608551
[amino(dimethylamino)methylidene]-dimethylazanium;6-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexanoate (PubChem CID 163608551) has the molecular formula C21H28F17N3O2S and a molecular weight of 709.51 g/mol. Its IUPAC name is [amino(dimethylamino)methylidene]-dimethylazanium;6-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexanoate.
| Compound Name | [amino(dimethylamino)methylidene]-dimethylazanium;6-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 163608551 |
| Molecular Formula | C21H28F17N3O2S |
| Molecular Weight | 709.51 g/mol |
| Exact Mass | 709.16 |
| IUPAC Name | [amino(dimethylamino)methylidene]-dimethylazanium;6-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)hexanoate |
| SMILES | CN(C)C(N)=[N+](C)C.O=C([O-])CCCCCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H15F17O2S.C5H13N3/c17-9(18,5-7-36-6-3-1-2-4-8(34)35)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33;1-7(2)5(6)8(3)4/h1-7H2,(H,34,35);6H,1-4H3 |
| InChIKey | HDXROKPRDKHFKP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|