C2H6NO4P — CID 18697532
2-hydroxy-1,3,5,2λ5-dioxazaphosphinane 2-oxide (PubChem CID 18697532) has the molecular formula C2H6NO4P and a molecular weight of 139.05 g/mol. Its IUPAC name is 2-hydroxy-1,3,5,2λ5-dioxazaphosphinane 2-oxide.
| Compound Name | 2-hydroxy-1,3,5,2λ5-dioxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 18697532 |
| Molecular Formula | C2H6NO4P |
| Molecular Weight | 139.05 g/mol |
| Exact Mass | 139.00 |
| IUPAC Name | 2-hydroxy-1,3,5,2λ5-dioxazaphosphinane 2-oxide |
| SMILES | O=P1(O)OCNCO1 |
| InChI | InChI=1S/C2H6NO4P/c4-8(5)6-1-3-2-7-8/h3H,1-2H2,(H,4,5) |
| InChIKey | HUJSQKUYGRADHC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.05 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|