C6H12N2O8P2 — CID 163691066
2,12-dihydroxy-2,12-dioxo-1,7-dioxa-4,10-diaza-2λ5,12λ5-diphosphacyclododecane-6,8-dione (PubChem CID 163691066) has the molecular formula C6H12N2O8P2 and a molecular weight of 302.12 g/mol. Its IUPAC name is 2,12-dihydroxy-2,12-dioxo-1,7-dioxa-4,10-diaza-2λ5,12λ5-diphosphacyclododecane-6,8-dione.
| Compound Name | 2,12-dihydroxy-2,12-dioxo-1,7-dioxa-4,10-diaza-2λ5,12λ5-diphosphacyclododecane-6,8-dione |
|---|---|
| PubChem CID | 163691066 |
| Molecular Formula | C6H12N2O8P2 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2,12-dihydroxy-2,12-dioxo-1,7-dioxa-4,10-diaza-2λ5,12λ5-diphosphacyclododecane-6,8-dione |
| SMILES | O=C1CNCP(=O)(O)OP(=O)(O)CNCC(=O)O1 |
| InChI | InChI=1S/C6H12N2O8P2/c9-5-1-7-3-17(11,12)16-18(13,14)4-8-2-6(10)15-5/h7-8H,1-4H2,(H,11,12)(H,13,14) |
| InChIKey | JSZOKQNUHFHKLA-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|