H6O12P6 — CID 71369580
1,2,3,4,5,6-hexahydroxy-1λ5,2λ5,3λ5,4λ5,5λ5,6λ5-hexaphosphinane 1,2,3,4,5,6-hexaoxide (PubChem CID 71369580) has the molecular formula H6O12P6 and a molecular weight of 383.88 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydroxy-1λ5,2λ5,3λ5,4λ5,5λ5,6λ5-hexaphosphinane 1,2,3,4,5,6-hexaoxide.
| Compound Name | 1,2,3,4,5,6-hexahydroxy-1λ5,2λ5,3λ5,4λ5,5λ5,6λ5-hexaphosphinane 1,2,3,4,5,6-hexaoxide |
|---|---|
| PubChem CID | 71369580 |
| Molecular Formula | H6O12P6 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.83 |
| IUPAC Name | 1,2,3,4,5,6-hexahydroxy-1λ5,2λ5,3λ5,4λ5,5λ5,6λ5-hexaphosphinane 1,2,3,4,5,6-hexaoxide |
| SMILES | O=P1(O)P(=O)(O)P(=O)(O)P(=O)(O)P(=O)(O)P1(=O)O |
| InChI | InChI=1S/H6O12P6/c1-13(2)14(3,4)16(7,8)18(11,12)17(9,10)15(13,5)6/h(H,1,2)(H,3,4)(H,5,6)(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | NSNMOFSOWMHERA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|