About 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide
9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide (PubChem CID 171050825) has the molecular formula C8H15O2P
and a molecular weight of 174.18 g/mol. Its IUPAC name is 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide.
Molecular Properties
| Compound Name | 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide |
| PubChem CID | 171050825 |
| Molecular Formula | C8H15O2P |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide |
| SMILES | O=P1(O)C2CCCC1CCC2 |
| InChI | InChI=1S/C8H15O2P/c9-11(10)7-3-1-4-8(11)6-2-5-7/h7-8H,1-6H2,(H,9,10) |
| InChIKey | ZGZSTFZKADJXJH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide?
The IUPAC name of 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide (CID 171050825) is 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide.
What is the SMILES notation for 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide?
The canonical SMILES for 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide is O=P1(O)C2CCCC1CCC2.
What is the InChIKey of 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide?
The InChIKey is ZGZSTFZKADJXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O2P/c9-11(10)7-3-1-4-8(11)6-2-5-7/h7-8H,1-6H2,(H,9,10).
What are the key properties of 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide?
9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide has a molecular weight of 174.18 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-9λ5-phosphabicyclo[3.3.1]nonane 9-oxide is sourced from PubChem (CID 171050825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).