About 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene
9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene (PubChem CID 123249112) has the molecular formula C8H15O2P
and a molecular weight of 174.18 g/mol. Its IUPAC name is 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene.
Molecular Properties
| Compound Name | 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene |
| PubChem CID | 123249112 |
| Molecular Formula | C8H15O2P |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene |
| SMILES | OP1(O)=C2CCCCC1CC2 |
| InChI | InChI=1S/C8H15O2P/c9-11(10)7-3-1-2-4-8(11)6-5-7/h7,9-10H,1-6H2 |
| InChIKey | KOBRNVLVACNOIW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene?
The IUPAC name of 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene (CID 123249112) is 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene.
What is the SMILES notation for 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene?
The canonical SMILES for 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene is OP1(O)=C2CCCCC1CC2.
What is the InChIKey of 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene?
The InChIKey is KOBRNVLVACNOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O2P/c9-11(10)7-3-1-2-4-8(11)6-5-7/h7,9-10H,1-6H2.
What are the key properties of 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene?
9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene has a molecular weight of 174.18 g/mol, XLogP of 1.73, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dihydroxy-9λ5-phosphabicyclo[4.2.1]non-1(9)-ene is sourced from PubChem (CID 123249112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).