C9H16 — CID 148695286
(1E,2S)-1-ethylidene-2-methylcyclohexane (PubChem CID 148695286) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (1E,2S)-1-ethylidene-2-methylcyclohexane.
| Compound Name | (1E,2S)-1-ethylidene-2-methylcyclohexane |
|---|---|
| PubChem CID | 148695286 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (1E,2S)-1-ethylidene-2-methylcyclohexane |
| SMILES | C/C=C1\CCCC[C@@H]1C |
| InChI | InChI=1S/C9H16/c1-3-9-7-5-4-6-8(9)2/h3,8H,4-7H2,1-2H3/b9-3+/t8-/m0/s1 |
| InChIKey | NUHCEMOQRZEGAQ-FVKOELHVSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|