About hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine
hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine (PubChem CID 102271864) has the molecular formula C8H14N+
and a molecular weight of 124.21 g/mol. Its IUPAC name is hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine.
Molecular Properties
| Compound Name | hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine |
| PubChem CID | 102271864 |
| Molecular Formula | C8H14N+ |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine |
| SMILES | [H+].[H]/N=C/C=C1\CCCC1C |
| InChI | InChI=1S/C8H13N/c1-7-3-2-4-8(7)5-6-9/h5-7,9H,2-4H2,1H3/p+1/b8-5+,9-6+ |
| InChIKey | OOVOBKFEYBHGHX-XVYDYJIPSA-O |
| XLogP | 2.49 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine?
The IUPAC name of hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine (CID 102271864) is hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine.
What is the SMILES notation for hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine?
The canonical SMILES for hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine is [H+].[H]/N=C/C=C1\CCCC1C.
What is the InChIKey of hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine?
The InChIKey is OOVOBKFEYBHGHX-XVYDYJIPSA-O. The full InChI is InChI=1S/C8H13N/c1-7-3-2-4-8(7)5-6-9/h5-7,9H,2-4H2,1H3/p+1/b8-5+,9-6+.
What are the key properties of hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine?
hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine has a molecular weight of 124.21 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;(2E)-2-(2-methylcyclopentylidene)ethanimine is sourced from PubChem (CID 102271864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).