C17H32 — CID 123384032
2-ethyl-1,5-dimethyl-6-propylidenecyclodecane (PubChem CID 123384032) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 2-ethyl-1,5-dimethyl-6-propylidenecyclodecane.
| Compound Name | 2-ethyl-1,5-dimethyl-6-propylidenecyclodecane |
|---|---|
| PubChem CID | 123384032 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 2-ethyl-1,5-dimethyl-6-propylidenecyclodecane |
| SMILES | CCC=C1CCCCC(C)C(CC)CCC1C |
| InChI | InChI=1S/C17H32/c1-5-9-17-11-8-7-10-14(3)16(6-2)13-12-15(17)4/h9,14-16H,5-8,10-13H2,1-4H3 |
| InChIKey | NJDQJAQAOXSPLI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|