C20H36O — CID 143830266
(2Z)-2-(6-ethyl-2,3,7-trimethyl-2-propylcyclodecylidene)acetaldehyde (PubChem CID 143830266) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (2Z)-2-(6-ethyl-2,3,7-trimethyl-2-propylcyclodecylidene)acetaldehyde.
| Compound Name | (2Z)-2-(6-ethyl-2,3,7-trimethyl-2-propylcyclodecylidene)acetaldehyde |
|---|---|
| PubChem CID | 143830266 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (2Z)-2-(6-ethyl-2,3,7-trimethyl-2-propylcyclodecylidene)acetaldehyde |
| SMILES | CCCC1(C)/C(=C\C=O)CCCC(C)C(CC)CCC1C |
| InChI | InChI=1S/C20H36O/c1-6-14-20(5)17(4)11-12-18(7-2)16(3)9-8-10-19(20)13-15-21/h13,15-18H,6-12,14H2,1-5H3/b19-13- |
| InChIKey | OBNDQPTZJPLPKA-UYRXBGFRSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|