C5H11NO5P2 — CID 101154328
2,4-dihydroxy-3-pyrrolidin-1-yl-1,2λ5,4λ5-oxadiphosphetane 2,4-dioxide (PubChem CID 101154328) has the molecular formula C5H11NO5P2 and a molecular weight of 227.09 g/mol. Its IUPAC name is 2,4-dihydroxy-3-pyrrolidin-1-yl-1,2λ5,4λ5-oxadiphosphetane 2,4-dioxide.
| Compound Name | 2,4-dihydroxy-3-pyrrolidin-1-yl-1,2λ5,4λ5-oxadiphosphetane 2,4-dioxide |
|---|---|
| PubChem CID | 101154328 |
| Molecular Formula | C5H11NO5P2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 2,4-dihydroxy-3-pyrrolidin-1-yl-1,2λ5,4λ5-oxadiphosphetane 2,4-dioxide |
| SMILES | O=P1(O)OP(=O)(O)C1N1CCCC1 |
| InChI | InChI=1S/C5H11NO5P2/c7-12(8)5(13(9,10)11-12)6-3-1-2-4-6/h5H,1-4H2,(H,7,8)(H,9,10) |
| InChIKey | HTVNOPHMGIBPSL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|